C31H31N3O4 — CID 3190705
2-[1,3-benzodioxol-5-yl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-phenylacetamide (PubChem CID 3190705) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-phenylacetamide.
| Compound Name | 2-[1,3-benzodioxol-5-yl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-phenylacetamide |
|---|---|
| PubChem CID | 3190705 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-phenylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccccc1)N(C(=O)Cc1c[nH]c2ccccc12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H31N3O4/c35-29(17-22-19-32-26-14-8-7-13-25(22)26)34(24-15-16-27-28(18-24)38-20-37-27)30(21-9-3-1-4-10-21)31(36)33-23-11-5-2-6-12-23/h1,3-4,7-10,13-16,18-19,23,30,32H,2,5-6,11-12,17,20H2,(H,33,36) |
| InChIKey | UJBICORQUXCYPI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |