C32H35N3O4 — CID 3190755
N-cyclohexyl-2-(3,4-dimethoxyphenyl)-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)acetamide (PubChem CID 3190755) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4-dimethoxyphenyl)-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)acetamide.
| Compound Name | N-cyclohexyl-2-(3,4-dimethoxyphenyl)-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)acetamide |
|---|---|
| PubChem CID | 3190755 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-cyclohexyl-2-(3,4-dimethoxyphenyl)-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCC2)N(C(=O)Cc2c[nH]c3ccccc23)c2ccccc2)cc1OC |
| InChI | InChI=1S/C32H35N3O4/c1-38-28-18-17-22(19-29(28)39-2)31(32(37)34-24-11-5-3-6-12-24)35(25-13-7-4-8-14-25)30(36)20-23-21-33-27-16-10-9-15-26(23)27/h4,7-10,13-19,21,24,31,33H,3,5-6,11-12,20H2,1-2H3,(H,34,37) |
| InChIKey | YHYAJPHULSOQRA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |