C27H31N3O4S — CID 31909479
N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 31909479) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 31909479 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc([C@H](CN2CCOCC2)NC(=O)c2cccc(S(=O)(=O)N(C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H31N3O4S/c1-21-11-13-22(14-12-21)26(20-30-15-17-34-18-16-30)28-27(31)23-7-6-10-25(19-23)35(32,33)29(2)24-8-4-3-5-9-24/h3-14,19,26H,15-18,20H2,1-2H3,(H,28,31)/t26-/m0/s1 |
| InChIKey | DENRECXSYHCZHY-SANMLTNESA-N |
| XLogP | 3.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |