C30H33N3O3 — CID 3190948
2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(5-methylfuran-2-yl)acetamide (PubChem CID 3190948) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(5-methylfuran-2-yl)acetamide.
| Compound Name | 2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(5-methylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 3190948 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(5-methylfuran-2-yl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCCC2)N(Cc2ccccc2)C(=O)Cc2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C30H33N3O3/c1-21-16-17-27(36-21)29(30(35)32-24-12-6-3-7-13-24)33(20-22-10-4-2-5-11-22)28(34)18-23-19-31-26-15-9-8-14-25(23)26/h2,4-5,8-11,14-17,19,24,29,31H,3,6-7,12-13,18,20H2,1H3,(H,32,35) |
| InChIKey | RVLNJSBWGUYYJD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |