C16H20N4O3S — CID 31909611
[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-(1H-indazol-3-yl)methanone (PubChem CID 31909611) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is [4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-(1H-indazol-3-yl)methanone.
| Compound Name | [4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 31909611 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCN([C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H20N4O3S/c21-16(15-13-3-1-2-4-14(13)17-18-15)20-8-6-19(7-9-20)12-5-10-24(22,23)11-12/h1-4,12H,5-11H2,(H,17,18)/t12-/m1/s1 |
| InChIKey | GHHWNXQYSIGJSO-GFCCVEGCSA-N |
| XLogP | 0.51 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |