C16H23N3O2S — CID 31913125
N-(1-ethylpyrazol-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 31913125) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 31913125 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | CCn1cc(NS(=O)(=O)c2c(C)c(C)c(C)c(C)c2C)cn1 |
| InChI | InChI=1S/C16H23N3O2S/c1-7-19-9-15(8-17-19)18-22(20,21)16-13(5)11(3)10(2)12(4)14(16)6/h8-9,18H,7H2,1-6H3 |
| InChIKey | JGZXFDSTBTZOFT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |