About (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide
(E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide (PubChem CID 31913463) has the molecular formula C18H18N4O2S
and a molecular weight of 354.44 g/mol. Its IUPAC name is (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide.
Molecular Properties
| Compound Name | (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide |
| PubChem CID | 31913463 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide |
| SMILES | Cc1cc(C)n(-c2ccc(NS(=O)(=O)/C=C/c3ccccc3)cn2)n1 |
| InChI | InChI=1S/C18H18N4O2S/c1-14-12-15(2)22(20-14)18-9-8-17(13-19-18)21-25(23,24)11-10-16-6-4-3-5-7-16/h3-13,21H,1-2H3/b11-10+ |
| InChIKey | XEXAIUCMAJQGTI-ZHACJKMWSA-N |
| XLogP | 3.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide?
The IUPAC name of (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide (CID 31913463) is (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide.
What is the SMILES notation for (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide?
The canonical SMILES for (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide is Cc1cc(C)n(-c2ccc(NS(=O)(=O)/C=C/c3ccccc3)cn2)n1.
What is the InChIKey of (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide?
The InChIKey is XEXAIUCMAJQGTI-ZHACJKMWSA-N. The full InChI is InChI=1S/C18H18N4O2S/c1-14-12-15(2)22(20-14)18-9-8-17(13-19-18)21-25(23,24)11-10-16-6-4-3-5-7-16/h3-13,21H,1-2H3/b11-10+.
What are the key properties of (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide?
(E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide has a molecular weight of 354.44 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-phenylethenesulfonamide is sourced from PubChem (CID 31913463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).