C38H37N5O2 — CID 3191850
2-[[2-(benzotriazol-1-yl)acetyl]-(2-phenylethyl)amino]-N-cyclohexyl-2-[3-(2-phenylethynyl)phenyl]acetamide (PubChem CID 3191850) has the molecular formula C38H37N5O2 and a molecular weight of 595.75 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(2-phenylethyl)amino]-N-cyclohexyl-2-[3-(2-phenylethynyl)phenyl]acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(2-phenylethyl)amino]-N-cyclohexyl-2-[3-(2-phenylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3191850 |
| Molecular Formula | C38H37N5O2 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(2-phenylethyl)amino]-N-cyclohexyl-2-[3-(2-phenylethynyl)phenyl]acetamide |
| SMILES | O=C(NC1CCCCC1)C(c1cccc(C#Cc2ccccc2)c1)N(CCc1ccccc1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C38H37N5O2/c44-36(28-43-35-22-11-10-21-34(35)40-41-43)42(26-25-30-15-6-2-7-16-30)37(38(45)39-33-19-8-3-9-20-33)32-18-12-17-31(27-32)24-23-29-13-4-1-5-14-29/h1-2,4-7,10-18,21-22,27,33,37H,3,8-9,19-20,25-26,28H2,(H,39,45) |
| InChIKey | HKNZRDAYZIXYMT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|