About 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide
2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 3192333) has the molecular formula C19H19N3OS
and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
| PubChem CID | 3192333 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(C)c(Nc2ncccc2C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C19H19N3OS/c1-13-7-8-14(2)17(11-13)22-18-16(6-3-9-20-18)19(23)21-12-15-5-4-10-24-15/h3-11H,12H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZOKWMXAWMBRWRQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide?
The IUPAC name of 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide (CID 3192333) is 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide.
What is the SMILES notation for 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide?
The canonical SMILES for 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide is Cc1ccc(C)c(Nc2ncccc2C(=O)NCc2cccs2)c1.
What is the InChIKey of 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide?
The InChIKey is ZOKWMXAWMBRWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3OS/c1-13-7-8-14(2)17(11-13)22-18-16(6-3-9-20-18)19(23)21-12-15-5-4-10-24-15/h3-11H,12H2,1-2H3,(H,20,22)(H,21,23).
What are the key properties of 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide?
2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide has a molecular weight of 337.45 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylanilino)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide is sourced from PubChem (CID 3192333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).