About Phanurane
Phanurane (PubChem CID 319260) has the molecular formula C22H28O3
and a molecular weight of 340.50 g/mol. Its IUPAC name is 10,13-dimethylspiro[2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
Molecular Properties
| Compound Name | Phanurane |
| PubChem CID | 319260 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 10,13-dimethylspiro[2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | CC12CCC(=O)C=C1C=CC3C2CCC4(C3CCC45CCC(=O)O5)C |
| InChI | InChI=1S/C22H28O3/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21)12-8-19(24)25-22/h3-4,13,16-18H,5-12H2,1-2H3 |
| InChIKey | UJVLDDZCTMKXJK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | 719 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Phanurane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phanurane?
The IUPAC name of Phanurane (CID 319260) is 10,13-dimethylspiro[2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
What is the SMILES notation for Phanurane?
The canonical SMILES for Phanurane is CC12CCC(=O)C=C1C=CC3C2CCC4(C3CCC45CCC(=O)O5)C.
What is the InChIKey of Phanurane?
The InChIKey is UJVLDDZCTMKXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O3/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21)12-8-19(24)25-22/h3-4,13,16-18H,5-12H2,1-2H3.
What are the key properties of Phanurane?
Phanurane has a molecular weight of 340.50 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Phanurane is sourced from PubChem (CID 319260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).