C19H20FNO2 — CID 31935022
1-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]cyclobutane-1-carboxamide (PubChem CID 31935022) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 31935022 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]cyclobutane-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2(c3cccc(F)c3)CCC2)cc1 |
| InChI | InChI=1S/C19H20FNO2/c1-23-17-8-6-14(7-9-17)13-21-18(22)19(10-3-11-19)15-4-2-5-16(20)12-15/h2,4-9,12H,3,10-11,13H2,1H3,(H,21,22) |
| InChIKey | GSZOHYJMPVHUBZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |