C17H18ClN3O2 — CID 31936113
2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylpyridine-4-carboxamide (PubChem CID 31936113) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 31936113 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylpyridine-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-11-5-4-6-12(2)16(11)20-15(22)10-21(3)17(23)13-7-8-19-14(18)9-13/h4-9H,10H2,1-3H3,(H,20,22) |
| InChIKey | YKFPEEFJRPPLSZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|