C19H30N4O5S — CID 31940152
3-[4-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-4-oxobutyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 31940152) has the molecular formula C19H30N4O5S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[4-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-4-oxobutyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[4-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-4-oxobutyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 31940152 |
| Molecular Formula | C19H30N4O5S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[4-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-4-oxobutyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)N1CCN([C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C19H30N4O5S/c24-16(22-11-9-21(10-12-22)15-5-13-29(27,28)14-15)4-3-8-23-17(25)19(20-18(23)26)6-1-2-7-19/h15H,1-14H2,(H,20,26)/t15-/m1/s1 |
| InChIKey | UDCCINLUGLERAG-OAHLLOKOSA-N |
| XLogP | -0.04 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|