C23H24ClN3O3 — CID 3194371
3-(4-chlorophenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea (PubChem CID 3194371) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 3-(4-chlorophenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 3194371 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1cccc2cc(CN(CC3CCCO3)C(=O)Nc3ccc(Cl)cc3)c(=O)[nH]c12 |
| InChI | InChI=1S/C23H24ClN3O3/c1-15-4-2-5-16-12-17(22(28)26-21(15)16)13-27(14-20-6-3-11-30-20)23(29)25-19-9-7-18(24)8-10-19/h2,4-5,7-10,12,20H,3,6,11,13-14H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | GKSZNHIBMPVALX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |