C25H29N3O4 — CID 3194801
1-cyclopentyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyphenyl)urea (PubChem CID 3194801) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-cyclopentyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 3194801 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-cyclopentyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methoxyphenyl)urea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(C(=O)Nc3ccccc3OC)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C25H29N3O4/c1-3-32-20-12-13-21-17(15-20)14-18(24(29)26-21)16-28(19-8-4-5-9-19)25(30)27-22-10-6-7-11-23(22)31-2/h6-7,10-15,19H,3-5,8-9,16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | KVRRHDAZJJXJEG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |