C15H17F3N4O2S — CID 31951218
2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 31951218) has the molecular formula C15H17F3N4O2S and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 31951218 |
| Molecular Formula | C15H17F3N4O2S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCc1nnc(NC(=O)Cn2cccc(C(F)(F)F)c2=O)s1 |
| InChI | InChI=1S/C15H17F3N4O2S/c1-2-3-4-7-12-20-21-14(25-12)19-11(23)9-22-8-5-6-10(13(22)24)15(16,17)18/h5-6,8H,2-4,7,9H2,1H3,(H,19,21,23) |
| InChIKey | VUBFHSOBJXNGNI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|