C28H31N5O2 — CID 3195417
2-(N-[2-(benzotriazol-1-yl)acetyl]-3-methylanilino)-N-(3-methylbutyl)-2-phenylacetamide (PubChem CID 3195417) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-(N-[2-(benzotriazol-1-yl)acetyl]-3-methylanilino)-N-(3-methylbutyl)-2-phenylacetamide.
| Compound Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-3-methylanilino)-N-(3-methylbutyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 3195417 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-3-methylanilino)-N-(3-methylbutyl)-2-phenylacetamide |
| SMILES | Cc1cccc(N(C(=O)Cn2nnc3ccccc32)C(C(=O)NCCC(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C28H31N5O2/c1-20(2)16-17-29-28(35)27(22-11-5-4-6-12-22)33(23-13-9-10-21(3)18-23)26(34)19-32-25-15-8-7-14-24(25)30-31-32/h4-15,18,20,27H,16-17,19H2,1-3H3,(H,29,35) |
| InChIKey | KOWQEANINWWSKA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |