C26H28N4O5S — CID 3195606
N-[5-ethyl-3-(2-methoxybenzoyl)thiophen-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 3195606) has the molecular formula C26H28N4O5S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[5-ethyl-3-(2-methoxybenzoyl)thiophen-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[5-ethyl-3-(2-methoxybenzoyl)thiophen-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3195606 |
| Molecular Formula | C26H28N4O5S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[5-ethyl-3-(2-methoxybenzoyl)thiophen-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | CCc1cc(C(=O)c2ccccc2OC)c(NC(=O)CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)s1 |
| InChI | InChI=1S/C26H28N4O5S/c1-3-20-16-22(25(32)21-6-4-5-7-23(21)35-2)26(36-20)27-24(31)17-28-12-14-29(15-13-28)18-8-10-19(11-9-18)30(33)34/h4-11,16H,3,12-15,17H2,1-2H3,(H,27,31) |
| InChIKey | NBCJTRVNHXFIQR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|