C17H12Cl2N4O3S2 — CID 31959439
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 31959439) has the molecular formula C17H12Cl2N4O3S2 and a molecular weight of 455.35 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 31959439 |
| Molecular Formula | C17H12Cl2N4O3S2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2Cl)cs1)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C17H12Cl2N4O3S2/c18-11-2-3-12(13(19)7-11)14-9-27-17(20-14)21-16(24)10-1-4-15-22-28(25,26)6-5-23(15)8-10/h1-4,7-9H,5-6H2,(H,20,21,24) |
| InChIKey | XPXAWLWLFGAOIM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |