About 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile
2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 31962165) has the molecular formula C25H34N4O
and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
| PubChem CID | 31962165 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | CC(C)(C)c1cc(CN2CCN(c3cc(C#N)ccn3)CC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34N4O/c1-24(2,3)20-14-19(23(30)21(15-20)25(4,5)6)17-28-9-11-29(12-10-28)22-13-18(16-26)7-8-27-22/h7-8,13-15,30H,9-12,17H2,1-6H3 |
| InChIKey | GYPRMHLUQKHHCO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
The IUPAC name of 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile (CID 31962165) is 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile is CC(C)(C)c1cc(CN2CCN(c3cc(C#N)ccn3)CC2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
The InChIKey is GYPRMHLUQKHHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N4O/c1-24(2,3)20-14-19(23(30)21(15-20)25(4,5)6)17-28-9-11-29(12-10-28)22-13-18(16-26)7-8-27-22/h7-8,13-15,30H,9-12,17H2,1-6H3.
What are the key properties of 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile?
2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile has a molecular weight of 406.57 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]pyridine-4-carbonitrile is sourced from PubChem (CID 31962165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).