C19H24N2O4S — CID 3196588
N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 3196588) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3196588 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCN(C(=O)c1ccco1)C(C(=O)NC1CCCC1)c1cccs1 |
| InChI | InChI=1S/C19H24N2O4S/c1-24-12-10-21(19(23)15-8-4-11-25-15)17(16-9-5-13-26-16)18(22)20-14-6-2-3-7-14/h4-5,8-9,11,13-14,17H,2-3,6-7,10,12H2,1H3,(H,20,22) |
| InChIKey | PLKIKZQGQPAMTA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |