C19H28N2O4S — CID 31967351
N-[3-(3-methoxypropylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]oxane-4-carboxamide (PubChem CID 31967351) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[3-(3-methoxypropylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]oxane-4-carboxamide.
| Compound Name | N-[3-(3-methoxypropylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 31967351 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[3-(3-methoxypropylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]oxane-4-carboxamide |
| SMILES | COCCCNC(=O)c1c(NC(=O)C2CCOCC2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H28N2O4S/c1-24-10-4-9-20-18(23)16-14-5-2-3-6-15(14)26-19(16)21-17(22)13-7-11-25-12-8-13/h13H,2-12H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | GBPQBFDXZYUQMJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|