About N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide
N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide (PubChem CID 3197325) has the molecular formula C26H34N4O3
and a molecular weight of 450.58 g/mol. Its IUPAC name is N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide.
Molecular Properties
| Compound Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide |
| PubChem CID | 3197325 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide |
| SMILES | CCc1ccccc1N(CC(=O)NC1CCCCC1)C(=O)CCCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C26H34N4O3/c1-2-20-11-6-7-14-22(20)30(19-25(32)28-21-12-4-3-5-13-21)26(33)17-10-16-24(31)29-23-15-8-9-18-27-23/h6-9,11,14-15,18,21H,2-5,10,12-13,16-17,19H2,1H3,(H,28,32)(H,27,29,31) |
| InChIKey | PXAMTQBCJTVFHV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide?
The IUPAC name of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide (CID 3197325) is N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide.
What is the SMILES notation for N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide?
The canonical SMILES for N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide is CCc1ccccc1N(CC(=O)NC1CCCCC1)C(=O)CCCC(=O)Nc1ccccn1.
What is the InChIKey of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide?
The InChIKey is PXAMTQBCJTVFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N4O3/c1-2-20-11-6-7-14-22(20)30(19-25(32)28-21-12-4-3-5-13-21)26(33)17-10-16-24(31)29-23-15-8-9-18-27-23/h6-9,11,14-15,18,21H,2-5,10,12-13,16-17,19H2,1H3,(H,28,32)(H,27,29,31).
What are the key properties of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide?
N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide has a molecular weight of 450.58 g/mol, XLogP of 4.23, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide is sourced from PubChem (CID 3197325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).