C33H39FN4O4 — CID 3197371
N'-(4-butoxyphenyl)-N'-[2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-pyridin-2-ylpentanediamide (PubChem CID 3197371) has the molecular formula C33H39FN4O4 and a molecular weight of 574.70 g/mol. Its IUPAC name is N'-(4-butoxyphenyl)-N'-[2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-pyridin-2-ylpentanediamide.
| Compound Name | N'-(4-butoxyphenyl)-N'-[2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-pyridin-2-ylpentanediamide |
|---|---|
| PubChem CID | 3197371 |
| Molecular Formula | C33H39FN4O4 |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | N'-(4-butoxyphenyl)-N'-[2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-pyridin-2-ylpentanediamide |
| SMILES | CCCCOc1ccc(N(C(=O)CCCC(=O)Nc2ccccn2)C(C(=O)NC2CCCC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H39FN4O4/c1-2-3-23-42-28-20-18-27(19-21-28)38(31(40)13-8-12-30(39)37-29-11-6-7-22-35-29)32(24-14-16-25(34)17-15-24)33(41)36-26-9-4-5-10-26/h6-7,11,14-22,26,32H,2-5,8-10,12-13,23H2,1H3,(H,36,41)(H,35,37,39) |
| InChIKey | WCZNEUULQJJNPG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|