C31H35ClN4O3 — CID 3197375
N'-[1-(4-chlorophenyl)-2-(cyclopentylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide (PubChem CID 3197375) has the molecular formula C31H35ClN4O3 and a molecular weight of 547.10 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)-2-(cyclopentylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide.
| Compound Name | N'-[1-(4-chlorophenyl)-2-(cyclopentylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide |
|---|---|
| PubChem CID | 3197375 |
| Molecular Formula | C31H35ClN4O3 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | N'-[1-(4-chlorophenyl)-2-(cyclopentylamino)-2-oxoethyl]-N'-(2-ethylphenyl)-N-pyridin-2-ylpentanediamide |
| SMILES | CCc1ccccc1N(C(=O)CCCC(=O)Nc1ccccn1)C(C(=O)NC1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H35ClN4O3/c1-2-22-10-3-6-13-26(22)36(29(38)16-9-15-28(37)35-27-14-7-8-21-33-27)30(23-17-19-24(32)20-18-23)31(39)34-25-11-4-5-12-25/h3,6-8,10,13-14,17-21,25,30H,2,4-5,9,11-12,15-16H2,1H3,(H,34,39)(H,33,35,37) |
| InChIKey | WESCJOHLHUKIKH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |