About 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine
3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine (PubChem CID 3197688) has the molecular formula C18H21BrN4
and a molecular weight of 373.30 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine |
| PubChem CID | 3197688 |
| Molecular Formula | C18H21BrN4 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine |
| SMILES | CCCCc1nc2cc(N)c(C)nc2n1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrN4/c1-3-4-5-17-22-16-10-15(20)12(2)21-18(16)23(17)11-13-6-8-14(19)9-7-13/h6-10H,3-5,11,20H2,1-2H3 |
| InChIKey | OHPVNVQDURUJRQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine?
The IUPAC name of 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine (CID 3197688) is 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine?
The canonical SMILES for 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine is CCCCc1nc2cc(N)c(C)nc2n1Cc1ccc(Br)cc1.
What is the InChIKey of 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine?
The InChIKey is OHPVNVQDURUJRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21BrN4/c1-3-4-5-17-22-16-10-15(20)12(2)21-18(16)23(17)11-13-6-8-14(19)9-7-13/h6-10H,3-5,11,20H2,1-2H3.
What are the key properties of 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine?
3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine has a molecular weight of 373.30 g/mol, XLogP of 4.48, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromophenyl)methyl]-2-butyl-5-methylimidazo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 3197688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).