C16H22N4OS — CID 31979109
2-[[cyclopentyl(cyclopropyl)amino]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 31979109) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[[cyclopentyl(cyclopropyl)amino]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopentyl(cyclopropyl)amino]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 31979109 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[[cyclopentyl(cyclopropyl)amino]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccco2)nn(CN(C2CCCC2)C2CC2)c1=S |
| InChI | InChI=1S/C16H22N4OS/c1-18-15(14-7-4-10-21-14)17-20(16(18)22)11-19(13-8-9-13)12-5-2-3-6-12/h4,7,10,12-13H,2-3,5-6,8-9,11H2,1H3 |
| InChIKey | JJNQPYREJLIRGB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|