C28H39N5O5 — CID 3198069
2-[[2-(benzotriazol-1-yl)acetyl]-(3-ethoxypropyl)amino]-N-tert-butyl-2-(4-ethoxy-3-methoxyphenyl)acetamide (PubChem CID 3198069) has the molecular formula C28H39N5O5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(3-ethoxypropyl)amino]-N-tert-butyl-2-(4-ethoxy-3-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(3-ethoxypropyl)amino]-N-tert-butyl-2-(4-ethoxy-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3198069 |
| Molecular Formula | C28H39N5O5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(3-ethoxypropyl)amino]-N-tert-butyl-2-(4-ethoxy-3-methoxyphenyl)acetamide |
| SMILES | CCOCCCN(C(=O)Cn1nnc2ccccc21)C(C(=O)NC(C)(C)C)c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C28H39N5O5/c1-7-37-17-11-16-32(25(34)19-33-22-13-10-9-12-21(22)30-31-33)26(27(35)29-28(3,4)5)20-14-15-23(38-8-2)24(18-20)36-6/h9-10,12-15,18,26H,7-8,11,16-17,19H2,1-6H3,(H,29,35) |
| InChIKey | QFHFAPUJEVNTSM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|