C18H18N6O — CID 3198370
2-[5-(4-aminophenyl)tetrazol-2-yl]-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 3198370) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[5-(4-aminophenyl)tetrazol-2-yl]-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[5-(4-aminophenyl)tetrazol-2-yl]-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 3198370 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[5-(4-aminophenyl)tetrazol-2-yl]-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC1Cc2ccccc2N1C(=O)Cn1nnc(-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C18H18N6O/c1-12-10-14-4-2-3-5-16(14)24(12)17(25)11-23-21-18(20-22-23)13-6-8-15(19)9-7-13/h2-9,12H,10-11,19H2,1H3 |
| InChIKey | OZBMQTDVUDXDGI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|