C14H14F3N5OS — CID 3200329
5-cyclopropyl-N-(1,3-thiazol-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 3200329) has the molecular formula C14H14F3N5OS and a molecular weight of 357.36 g/mol. Its IUPAC name is 5-cyclopropyl-N-(1,3-thiazol-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-(1,3-thiazol-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3200329 |
| Molecular Formula | C14H14F3N5OS |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-cyclopropyl-N-(1,3-thiazol-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc2n(n1)C(C(F)(F)F)CC(C1CC1)N2 |
| InChI | InChI=1S/C14H14F3N5OS/c15-14(16,17)10-5-8(7-1-2-7)19-11-6-9(21-22(10)11)12(23)20-13-18-3-4-24-13/h3-4,6-8,10,19H,1-2,5H2,(H,18,20,23) |
| InChIKey | XTLZDCIWPOHRKK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |