C26H38N6O2 — CID 3200778
3-[[1-(1-tert-butyltetrazol-5-yl)propyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 3200778) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 3-[[1-(1-tert-butyltetrazol-5-yl)propyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[[1-(1-tert-butyltetrazol-5-yl)propyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3200778 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 3-[[1-(1-tert-butyltetrazol-5-yl)propyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(C3CCCCC3)C(CC)c3nnnn3C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C26H38N6O2/c1-6-23(24-28-29-30-32(24)26(3,4)5)31(20-11-9-8-10-12-20)17-19-15-18-16-21(34-7-2)13-14-22(18)27-25(19)33/h13-16,20,23H,6-12,17H2,1-5H3,(H,27,33) |
| InChIKey | ZBOPPWUNNDLRNI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |