C28H40N6O — CID 3203460
3-[[1-(1-cyclohexyltetrazol-5-yl)butyl-cyclopentylamino]methyl]-6-ethyl-1H-quinolin-2-one (PubChem CID 3203460) has the molecular formula C28H40N6O and a molecular weight of 476.67 g/mol. Its IUPAC name is 3-[[1-(1-cyclohexyltetrazol-5-yl)butyl-cyclopentylamino]methyl]-6-ethyl-1H-quinolin-2-one.
| Compound Name | 3-[[1-(1-cyclohexyltetrazol-5-yl)butyl-cyclopentylamino]methyl]-6-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3203460 |
| Molecular Formula | C28H40N6O |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 3-[[1-(1-cyclohexyltetrazol-5-yl)butyl-cyclopentylamino]methyl]-6-ethyl-1H-quinolin-2-one |
| SMILES | CCCC(c1nnnn1C1CCCCC1)N(Cc1cc2cc(CC)ccc2[nH]c1=O)C1CCCC1 |
| InChI | InChI=1S/C28H40N6O/c1-3-10-26(27-30-31-32-34(27)24-13-6-5-7-14-24)33(23-11-8-9-12-23)19-22-18-21-17-20(4-2)15-16-25(21)29-28(22)35/h15-18,23-24,26H,3-14,19H2,1-2H3,(H,29,35) |
| InChIKey | AXZLIOMLHYABIS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |