C27H32N6O — CID 3204662
3-[[1-(1-benzyltetrazol-5-yl)propyl-cyclopentylamino]methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 3204662) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[[1-(1-benzyltetrazol-5-yl)propyl-cyclopentylamino]methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[[1-(1-benzyltetrazol-5-yl)propyl-cyclopentylamino]methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3204662 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 3-[[1-(1-benzyltetrazol-5-yl)propyl-cyclopentylamino]methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | CCC(c1nnnn1Cc1ccccc1)N(Cc1cc2cccc(C)c2[nH]c1=O)C1CCCC1 |
| InChI | InChI=1S/C27H32N6O/c1-3-24(26-29-30-31-33(26)17-20-11-5-4-6-12-20)32(23-14-7-8-15-23)18-22-16-21-13-9-10-19(2)25(21)28-27(22)34/h4-6,9-13,16,23-24H,3,7-8,14-15,17-18H2,1-2H3,(H,28,34) |
| InChIKey | RRTRYDGLDLUVMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |