About N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide
N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3204784) has the molecular formula C26H28N4O3
and a molecular weight of 444.54 g/mol. Its IUPAC name is N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide |
| PubChem CID | 3204784 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)CCC(=O)Nc1ccccn1)NCCc1ccccc1 |
| InChI | InChI=1S/C26H28N4O3/c31-24(29-23-13-7-8-17-27-23)14-15-26(33)30(19-22-11-5-2-6-12-22)20-25(32)28-18-16-21-9-3-1-4-10-21/h1-13,17H,14-16,18-20H2,(H,28,32)(H,27,29,31) |
| InChIKey | WFPVPDXRCZGGCM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide (CID 3204784) is N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide is O=C(CN(Cc1ccccc1)C(=O)CCC(=O)Nc1ccccn1)NCCc1ccccc1.
What is the InChIKey of N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide?
The InChIKey is WFPVPDXRCZGGCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N4O3/c31-24(29-23-13-7-8-17-27-23)14-15-26(33)30(19-22-11-5-2-6-12-22)20-25(32)28-18-16-21-9-3-1-4-10-21/h1-13,17H,14-16,18-20H2,(H,28,32)(H,27,29,31).
What are the key properties of N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide?
N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide has a molecular weight of 444.54 g/mol, XLogP of 3.19, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-[2-oxo-2-(2-phenylethylamino)ethyl]-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 3204784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).