About N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide
N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3205142) has the molecular formula C23H30N4O4
and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| PubChem CID | 3205142 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | COc1ccccc1N(CC(=O)NCCC(C)C)C(=O)CCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C23H30N4O4/c1-17(2)13-15-25-22(29)16-27(18-8-4-5-9-19(18)31-3)23(30)12-11-21(28)26-20-10-6-7-14-24-20/h4-10,14,17H,11-13,15-16H2,1-3H3,(H,25,29)(H,24,26,28) |
| InChIKey | WSCBUURTGYLZBV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (CID 3205142) is N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is COc1ccccc1N(CC(=O)NCCC(C)C)C(=O)CCC(=O)Nc1ccccn1.
What is the InChIKey of N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The InChIKey is WSCBUURTGYLZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4O4/c1-17(2)13-15-25-22(29)16-27(18-8-4-5-9-19(18)31-3)23(30)12-11-21(28)26-20-10-6-7-14-24-20/h4-10,14,17H,11-13,15-16H2,1-3H3,(H,25,29)(H,24,26,28).
What are the key properties of N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide has a molecular weight of 426.52 g/mol, XLogP of 3.00, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyphenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 3205142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).