About N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide
N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide (PubChem CID 3205196) has the molecular formula C21H26N4O5
and a molecular weight of 414.46 g/mol. Its IUPAC name is N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide |
| PubChem CID | 3205196 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide |
| SMILES | COCCNC(=O)CN(C(=O)CCC(=O)Nc1ccccn1)c1ccccc1OC |
| InChI | InChI=1S/C21H26N4O5/c1-29-14-13-23-20(27)15-25(16-7-3-4-8-17(16)30-2)21(28)11-10-19(26)24-18-9-5-6-12-22-18/h3-9,12H,10-11,13-15H2,1-2H3,(H,23,27)(H,22,24,26) |
| InChIKey | SZFVCHLEDMSUPS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide (CID 3205196) is N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide is COCCNC(=O)CN(C(=O)CCC(=O)Nc1ccccn1)c1ccccc1OC.
What is the InChIKey of N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
The InChIKey is SZFVCHLEDMSUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O5/c1-29-14-13-23-20(27)15-25(16-7-3-4-8-17(16)30-2)21(28)11-10-19(26)24-18-9-5-6-12-22-18/h3-9,12H,10-11,13-15H2,1-2H3,(H,23,27)(H,22,24,26).
What are the key properties of N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide has a molecular weight of 414.46 g/mol, XLogP of 1.60, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 3205196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).