About N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide
N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3205208) has the molecular formula C24H32N4O5
and a molecular weight of 456.54 g/mol. Its IUPAC name is N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| PubChem CID | 3205208 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | CCCCOc1ccc(N(CC(=O)NCCOC)C(=O)CCC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C24H32N4O5/c1-3-4-16-33-20-10-8-19(9-11-20)28(18-23(30)26-15-17-32-2)24(31)13-12-22(29)27-21-7-5-6-14-25-21/h5-11,14H,3-4,12-13,15-18H2,1-2H3,(H,26,30)(H,25,27,29) |
| InChIKey | GTFWXKLPWWNJMD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (CID 3205208) is N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is CCCCOc1ccc(N(CC(=O)NCCOC)C(=O)CCC(=O)Nc2ccccn2)cc1.
What is the InChIKey of N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The InChIKey is GTFWXKLPWWNJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N4O5/c1-3-4-16-33-20-10-8-19(9-11-20)28(18-23(30)26-15-17-32-2)24(31)13-12-22(29)27-21-7-5-6-14-25-21/h5-11,14H,3-4,12-13,15-18H2,1-2H3,(H,26,30)(H,25,27,29).
What are the key properties of N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide has a molecular weight of 456.54 g/mol, XLogP of 2.78, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-butoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 3205208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).