About N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide
N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3205214) has the molecular formula C20H23FN4O4
and a molecular weight of 402.43 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| PubChem CID | 3205214 |
| Molecular Formula | C20H23FN4O4 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | COCCNC(=O)CN(C(=O)CCC(=O)Nc1ccccn1)c1ccccc1F |
| InChI | InChI=1S/C20H23FN4O4/c1-29-13-12-23-19(27)14-25(16-7-3-2-6-15(16)21)20(28)10-9-18(26)24-17-8-4-5-11-22-17/h2-8,11H,9-10,12-14H2,1H3,(H,23,27)(H,22,24,26) |
| InChIKey | DQTXBSOBJIYXHI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (CID 3205214) is N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is COCCNC(=O)CN(C(=O)CCC(=O)Nc1ccccn1)c1ccccc1F.
What is the InChIKey of N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The InChIKey is DQTXBSOBJIYXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN4O4/c1-29-13-12-23-19(27)14-25(16-7-3-2-6-15(16)21)20(28)10-9-18(26)24-17-8-4-5-11-22-17/h2-8,11H,9-10,12-14H2,1H3,(H,23,27)(H,22,24,26).
What are the key properties of N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide has a molecular weight of 402.43 g/mol, XLogP of 1.74, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 3205214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).