About N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide
N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 3205314) has the molecular formula C22H21FN4O3S
and a molecular weight of 440.50 g/mol. Its IUPAC name is N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide.
Molecular Properties
| Compound Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide |
| PubChem CID | 3205314 |
| Molecular Formula | C22H21FN4O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(CN(C(=O)CCC(=O)Nc1nccs1)c1ccccc1F)NCc1ccccc1 |
| InChI | InChI=1S/C22H21FN4O3S/c23-17-8-4-5-9-18(17)27(15-20(29)25-14-16-6-2-1-3-7-16)21(30)11-10-19(28)26-22-24-12-13-31-22/h1-9,12-13H,10-11,14-15H2,(H,25,29)(H,24,26,28) |
| InChIKey | FKJJLCZBOSKXJV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide?
The IUPAC name of N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide (CID 3205314) is N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide.
What is the SMILES notation for N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide?
The canonical SMILES for N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide is O=C(CN(C(=O)CCC(=O)Nc1nccs1)c1ccccc1F)NCc1ccccc1.
What is the InChIKey of N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide?
The InChIKey is FKJJLCZBOSKXJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN4O3S/c23-17-8-4-5-9-18(17)27(15-20(29)25-14-16-6-2-1-3-7-16)21(30)11-10-19(28)26-22-24-12-13-31-22/h1-9,12-13H,10-11,14-15H2,(H,25,29)(H,24,26,28).
What are the key properties of N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide?
N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide has a molecular weight of 440.50 g/mol, XLogP of 3.35, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-fluorophenyl)-N-(1,3-thiazol-2-yl)butanediamide is sourced from PubChem (CID 3205314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).