C25H27FN4O4S — CID 3205589
N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(4-methylphenyl)-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 3205589) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(4-methylphenyl)-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(4-methylphenyl)-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 3205589 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(4-methylphenyl)-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | COCCNC(=O)C(c1ccc(F)cc1)N(C(=O)CCC(=O)Nc1nccs1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27FN4O4S/c1-17-3-9-20(10-4-17)30(22(32)12-11-21(31)29-25-28-14-16-35-25)23(24(33)27-13-15-34-2)18-5-7-19(26)8-6-18/h3-10,14,16,23H,11-13,15H2,1-2H3,(H,27,33)(H,28,29,31) |
| InChIKey | ZADBASSHWGZLEV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|