C20H26N4O5S — CID 3205626
N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 3205626) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 3205626 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | COCCNC(=O)CN(Cc1ccc(OC)cc1)C(=O)CCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C20H26N4O5S/c1-28-11-9-21-18(26)14-24(13-15-3-5-16(29-2)6-4-15)19(27)8-7-17(25)23-20-22-10-12-30-20/h3-6,10,12H,7-9,11,13-14H2,1-2H3,(H,21,26)(H,22,23,25) |
| InChIKey | AAONCATVCKHNET-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|