About 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol
4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol (PubChem CID 3205780) has the molecular formula C22H19N3O3
and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol |
| PubChem CID | 3205780 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol |
| SMILES | Cc1ccn2c(NCc3ccc4c(c3)OCO4)c(-c3ccc(O)cc3)nc2c1 |
| InChI | InChI=1S/C22H19N3O3/c1-14-8-9-25-20(10-14)24-21(16-3-5-17(26)6-4-16)22(25)23-12-15-2-7-18-19(11-15)28-13-27-18/h2-11,23,26H,12-13H2,1H3 |
| InChIKey | RMNOPEFPXPCWOO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol?
The IUPAC name of 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol (CID 3205780) is 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol.
What is the SMILES notation for 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol?
The canonical SMILES for 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol is Cc1ccn2c(NCc3ccc4c(c3)OCO4)c(-c3ccc(O)cc3)nc2c1.
What is the InChIKey of 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol?
The InChIKey is RMNOPEFPXPCWOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3/c1-14-8-9-25-20(10-14)24-21(16-3-5-17(26)6-4-16)22(25)23-12-15-2-7-18-19(11-15)28-13-27-18/h2-11,23,26H,12-13H2,1H3.
What are the key properties of 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol?
4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol has a molecular weight of 373.41 g/mol, XLogP of 4.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,3-benzodioxol-5-ylmethylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenol is sourced from PubChem (CID 3205780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).