C27H30N4O4 — CID 3208417
N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-(4-methyl-2-pyridinyl)butanediamide (PubChem CID 3208417) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-(4-methyl-2-pyridinyl)butanediamide.
| Compound Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-(4-methyl-2-pyridinyl)butanediamide |
|---|---|
| PubChem CID | 3208417 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-(2-ethoxyphenyl)-N-(4-methyl-2-pyridinyl)butanediamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCc1ccccc1)C(=O)CCC(=O)Nc1cc(C)ccn1 |
| InChI | InChI=1S/C27H30N4O4/c1-3-35-23-12-8-7-11-22(23)31(19-26(33)29-18-21-9-5-4-6-10-21)27(34)14-13-25(32)30-24-17-20(2)15-16-28-24/h4-12,15-17H,3,13-14,18-19H2,1-2H3,(H,29,33)(H,28,30,32) |
| InChIKey | ZLZOHJWLJJSBDG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |