C23H27N3O3S — CID 3211059
N-[2-[[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-prop-2-enylamino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 3211059) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[2-[[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-prop-2-enylamino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-prop-2-enylamino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3211059 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[2-[[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-prop-2-enylamino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | C=CCN(C(=O)CNC(=O)c1cccs1)C(C(=O)NC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-2-14-26(20(27)16-24-22(28)19-13-8-15-30-19)21(17-9-4-3-5-10-17)23(29)25-18-11-6-7-12-18/h2-5,8-10,13,15,18,21H,1,6-7,11-12,14,16H2,(H,24,28)(H,25,29) |
| InChIKey | GGPMQVDOWURUNE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|