C27H28FN5O3 — CID 3212066
2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(2-methoxyethyl)-2-(2-methylphenyl)acetamide (PubChem CID 3212066) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(2-methoxyethyl)-2-(2-methylphenyl)acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(2-methoxyethyl)-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3212066 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(2-methoxyethyl)-2-(2-methylphenyl)acetamide |
| SMILES | COCCNC(=O)C(c1ccccc1C)N(Cc1ccc(F)cc1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C27H28FN5O3/c1-19-7-3-4-8-22(19)26(27(35)29-15-16-36-2)32(17-20-11-13-21(28)14-12-20)25(34)18-33-24-10-6-5-9-23(24)30-31-33/h3-14,26H,15-18H2,1-2H3,(H,29,35) |
| InChIKey | MITUKALWQTUJHN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|