C33H41N5O2S2 — CID 3212851
4-[2-(1-adamantyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3212851) has the molecular formula C33H41N5O2S2 and a molecular weight of 603.86 g/mol. Its IUPAC name is 4-[2-(1-adamantyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[2-(1-adamantyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3212851 |
| Molecular Formula | C33H41N5O2S2 |
| Molecular Weight | 603.86 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 4-[2-(1-adamantyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(c3nc(C45CC6CC(CC(C6)C4)C5)nc4sc5c(c34)CCCC5)CC2)c(OC)c1 |
| InChI | InChI=1S/C33H41N5O2S2/c1-39-23-7-8-25(26(16-23)40-2)34-32(41)38-11-9-37(10-12-38)29-28-24-5-3-4-6-27(24)42-30(28)36-31(35-29)33-17-20-13-21(18-33)15-22(14-20)19-33/h7-8,16,20-22H,3-6,9-15,17-19H2,1-2H3,(H,34,41) |
| InChIKey | QLGYLFXLENMXQA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.86 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|