C15H19N5O4S — CID 3212984
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[1-(3-methoxypropyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 3212984) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[1-(3-methoxypropyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[1-(3-methoxypropyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3212984 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[1-(3-methoxypropyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COCCCn1nnnc1SCC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H19N5O4S/c1-22-6-2-5-20-15(17-18-19-20)25-10-14(21)16-11-3-4-12-13(9-11)24-8-7-23-12/h3-4,9H,2,5-8,10H2,1H3,(H,16,21) |
| InChIKey | WRQFPWCUVPTXHA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|