About N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide
N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide (PubChem CID 3213301) has the molecular formula C19H20N4O
and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide |
| PubChem CID | 3213301 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc2nc(NCCNC(=O)c3ccncc3)c(C)cc2c1 |
| InChI | InChI=1S/C19H20N4O/c1-13-3-4-17-16(11-13)12-14(2)18(23-17)21-9-10-22-19(24)15-5-7-20-8-6-15/h3-8,11-12H,9-10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | HYNCAMOVAMNPOD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide?
The IUPAC name of N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide (CID 3213301) is N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide.
What is the SMILES notation for N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide?
The canonical SMILES for N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide is Cc1ccc2nc(NCCNC(=O)c3ccncc3)c(C)cc2c1.
What is the InChIKey of N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide?
The InChIKey is HYNCAMOVAMNPOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O/c1-13-3-4-17-16(11-13)12-14(2)18(23-17)21-9-10-22-19(24)15-5-7-20-8-6-15/h3-8,11-12H,9-10H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide?
N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide has a molecular weight of 320.40 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3,6-dimethylquinolin-2-yl)amino]ethyl]pyridine-4-carboxamide is sourced from PubChem (CID 3213301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).