C21H31N3O2 — CID 3216082
1-N-cyclohexyl-4-N-(2,4-dimethylphenyl)piperidine-1,4-dicarboxamide (PubChem CID 3216082) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-N-(2,4-dimethylphenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-cyclohexyl-4-N-(2,4-dimethylphenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3216082 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-N-cyclohexyl-4-N-(2,4-dimethylphenyl)piperidine-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(C(=O)NC3CCCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-15-8-9-19(16(2)14-15)23-20(25)17-10-12-24(13-11-17)21(26)22-18-6-4-3-5-7-18/h8-9,14,17-18H,3-7,10-13H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | FWHDUBJUYIDCGT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |