C23H22F2N2O2 — CID 3216711
N-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N-(2-fluorophenyl)prop-2-ynamide (PubChem CID 3216711) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N-(2-fluorophenyl)prop-2-ynamide.
| Compound Name | N-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N-(2-fluorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 3216711 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N-(2-fluorophenyl)prop-2-ynamide |
| SMILES | C#CC(=O)N(c1ccccc1F)C(C(=O)NC1CCCCC1)c1ccccc1F |
| InChI | InChI=1S/C23H22F2N2O2/c1-2-21(28)27(20-15-9-8-14-19(20)25)22(17-12-6-7-13-18(17)24)23(29)26-16-10-4-3-5-11-16/h1,6-9,12-16,22H,3-5,10-11H2,(H,26,29) |
| InChIKey | ASTDFTSAWXOCIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|